C17H12F3N5O3 — CID 17020711
5-cyclopropyl-7-(difluoromethyl)-N-(4-fluoro-3-nitrophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 17020711) has the molecular formula C17H12F3N5O3 and a molecular weight of 391.31 g/mol. Its IUPAC name is 5-cyclopropyl-7-(difluoromethyl)-N-(4-fluoro-3-nitrophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-cyclopropyl-7-(difluoromethyl)-N-(4-fluoro-3-nitrophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 17020711 |
| Molecular Formula | C17H12F3N5O3 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 5-cyclopropyl-7-(difluoromethyl)-N-(4-fluoro-3-nitrophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c([N+](=O)[O-])c1)c1cnn2c(C(F)F)cc(C3CC3)nc12 |
| InChI | InChI=1S/C17H12F3N5O3/c18-11-4-3-9(5-13(11)25(27)28)22-17(26)10-7-21-24-14(15(19)20)6-12(8-1-2-8)23-16(10)24/h3-8,15H,1-2H2,(H,22,26) |
| InChIKey | VIQCCHVJFNLZPG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|