C18H13F3N4O5 — CID 19508210
N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (PubChem CID 19508210) has the molecular formula C18H13F3N4O5 and a molecular weight of 422.32 g/mol. Its IUPAC name is N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19508210 |
| Molecular Formula | C18H13F3N4O5 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)c3cc(C(F)(F)F)[nH]n3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H13F3N4O5/c1-29-12-2-4-13(5-3-12)30-14-7-10(6-11(8-14)25(27)28)22-17(26)15-9-16(24-23-15)18(19,20)21/h2-9H,1H3,(H,22,26)(H,23,24) |
| InChIKey | CVEAIMWEARZTEV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|