C28H21FN2O7 — CID 3480513
4-(3,5-dimethoxybenzoyl)-N-[3-(4-fluorophenoxy)-5-nitrophenyl]benzamide (PubChem CID 3480513) has the molecular formula C28H21FN2O7 and a molecular weight of 516.48 g/mol. Its IUPAC name is 4-(3,5-dimethoxybenzoyl)-N-[3-(4-fluorophenoxy)-5-nitrophenyl]benzamide.
| Compound Name | 4-(3,5-dimethoxybenzoyl)-N-[3-(4-fluorophenoxy)-5-nitrophenyl]benzamide |
|---|---|
| PubChem CID | 3480513 |
| Molecular Formula | C28H21FN2O7 |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 4-(3,5-dimethoxybenzoyl)-N-[3-(4-fluorophenoxy)-5-nitrophenyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)c2ccc(C(=O)Nc3cc(Oc4ccc(F)cc4)cc([N+](=O)[O-])c3)cc2)c1 |
| InChI | InChI=1S/C28H21FN2O7/c1-36-24-11-19(12-25(16-24)37-2)27(32)17-3-5-18(6-4-17)28(33)30-21-13-22(31(34)35)15-26(14-21)38-23-9-7-20(29)8-10-23/h3-16H,1-2H3,(H,30,33) |
| InChIKey | KKHNPTQFPOSWDR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|