C28H22N2O6S — CID 4037181
4-(3,5-dimethoxybenzoyl)-N-(3-nitro-5-phenylsulfanylphenyl)benzamide (PubChem CID 4037181) has the molecular formula C28H22N2O6S and a molecular weight of 514.56 g/mol. Its IUPAC name is 4-(3,5-dimethoxybenzoyl)-N-(3-nitro-5-phenylsulfanylphenyl)benzamide.
| Compound Name | 4-(3,5-dimethoxybenzoyl)-N-(3-nitro-5-phenylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 4037181 |
| Molecular Formula | C28H22N2O6S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | 4-(3,5-dimethoxybenzoyl)-N-(3-nitro-5-phenylsulfanylphenyl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)c2ccc(C(=O)Nc3cc(Sc4ccccc4)cc([N+](=O)[O-])c3)cc2)c1 |
| InChI | InChI=1S/C28H22N2O6S/c1-35-23-12-20(13-24(17-23)36-2)27(31)18-8-10-19(11-9-18)28(32)29-21-14-22(30(33)34)16-26(15-21)37-25-6-4-3-5-7-25/h3-17H,1-2H3,(H,29,32) |
| InChIKey | RLZHFSYTULSZAI-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|