C26H22N2O6S — CID 19415309
5-[(3-methoxyphenoxy)methyl]-N-[3-(4-methylphenyl)sulfanyl-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19415309) has the molecular formula C26H22N2O6S and a molecular weight of 490.54 g/mol. Its IUPAC name is 5-[(3-methoxyphenoxy)methyl]-N-[3-(4-methylphenyl)sulfanyl-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(3-methoxyphenoxy)methyl]-N-[3-(4-methylphenyl)sulfanyl-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19415309 |
| Molecular Formula | C26H22N2O6S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 5-[(3-methoxyphenoxy)methyl]-N-[3-(4-methylphenyl)sulfanyl-5-nitrophenyl]furan-2-carboxamide |
| SMILES | COc1cccc(OCc2ccc(C(=O)Nc3cc(Sc4ccc(C)cc4)cc([N+](=O)[O-])c3)o2)c1 |
| InChI | InChI=1S/C26H22N2O6S/c1-17-6-9-23(10-7-17)35-24-13-18(12-19(14-24)28(30)31)27-26(29)25-11-8-22(34-25)16-33-21-5-3-4-20(15-21)32-2/h3-15H,16H2,1-2H3,(H,27,29) |
| InChIKey | QFUANMIDAVKOTB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|