C20H12F4N4O2 — CID 19451686
5-(4-fluorophenyl)-N-(2-hydroxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19451686) has the molecular formula C20H12F4N4O2 and a molecular weight of 416.33 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(2-hydroxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-(2-hydroxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19451686 |
| Molecular Formula | C20H12F4N4O2 |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(2-hydroxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1O)c1cc2nc(-c3ccc(F)cc3)cc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C20H12F4N4O2/c21-12-7-5-11(6-8-12)14-9-17(20(22,23)24)28-18(25-14)10-15(27-28)19(30)26-13-3-1-2-4-16(13)29/h1-10,29H,(H,26,30) |
| InChIKey | UPNXCUQXLAQIQS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|