C14H6F3N4O4- — CID 6967844
5-(4-nitrophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 6967844) has the molecular formula C14H6F3N4O4- and a molecular weight of 351.22 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | 5-(4-nitrophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 6967844 |
| Molecular Formula | C14H6F3N4O4- |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 5-(4-nitrophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | O=C([O-])c1cc2nc(-c3ccc([N+](=O)[O-])cc3)cc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C14H7F3N4O4/c15-14(16,17)11-5-9(7-1-3-8(4-2-7)21(24)25)18-12-6-10(13(22)23)19-20(11)12/h1-6H,(H,22,23)/p-1 |
| InChIKey | BNHYZIKHNVKZQJ-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 113.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|