C23H17F4N5O2 — CID 19292047
[(Z)-[amino-(4-fluorophenyl)methylidene]amino] 5-(3,4-dimethylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 19292047) has the molecular formula C23H17F4N5O2 and a molecular weight of 471.41 g/mol. Its IUPAC name is [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 5-(3,4-dimethylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 5-(3,4-dimethylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 19292047 |
| Molecular Formula | C23H17F4N5O2 |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 5-(3,4-dimethylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)n3nc(C(=O)O/N=C(\N)c4ccc(F)cc4)cc3n2)cc1C |
| InChI | InChI=1S/C23H17F4N5O2/c1-12-3-4-15(9-13(12)2)17-10-19(23(25,26)27)32-20(29-17)11-18(30-32)22(33)34-31-21(28)14-5-7-16(24)8-6-14/h3-11H,1-2H3,(H2,28,31) |
| InChIKey | ZGNUTGUOHKIIHJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|