C22H14Cl2F3N5O3 — CID 19293852
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 5-(4-methoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 19293852) has the molecular formula C22H14Cl2F3N5O3 and a molecular weight of 524.29 g/mol. Its IUPAC name is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 5-(4-methoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 5-(4-methoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 19293852 |
| Molecular Formula | C22H14Cl2F3N5O3 |
| Molecular Weight | 524.29 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 5-(4-methoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)n3ncc(C(=O)O/N=C(\N)c4ccc(Cl)cc4Cl)c3n2)cc1 |
| InChI | InChI=1S/C22H14Cl2F3N5O3/c1-34-13-5-2-11(3-6-13)17-9-18(22(25,26)27)32-20(30-17)15(10-29-32)21(33)35-31-19(28)14-7-4-12(23)8-16(14)24/h2-10H,1H3,(H2,28,31) |
| InChIKey | ALXDUUPRRUVWLP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.29 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|