C17H17ClF2N4O3 — CID 19296067
[(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetate (PubChem CID 19296067) has the molecular formula C17H17ClF2N4O3 and a molecular weight of 398.80 g/mol. Its IUPAC name is [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetate.
| Compound Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 19296067 |
| Molecular Formula | C17H17ClF2N4O3 |
| Molecular Weight | 398.80 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetate |
| SMILES | COc1ccc(Cl)cc1/C(N)=N/OC(=O)Cn1nc(C(F)F)cc1C1CC1 |
| InChI | InChI=1S/C17H17ClF2N4O3/c1-26-14-5-4-10(18)6-11(14)17(21)23-27-15(25)8-24-13(9-2-3-9)7-12(22-24)16(19)20/h4-7,9,16H,2-3,8H2,1H3,(H2,21,23) |
| InChIKey | NOUSMXGRXYOLPS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.80 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|