C14H14BrClN4O3 — CID 19296040
[(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-(4-bromopyrazol-1-yl)propanoate (PubChem CID 19296040) has the molecular formula C14H14BrClN4O3 and a molecular weight of 401.65 g/mol. Its IUPAC name is [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-(4-bromopyrazol-1-yl)propanoate.
| Compound Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-(4-bromopyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 19296040 |
| Molecular Formula | C14H14BrClN4O3 |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-(4-bromopyrazol-1-yl)propanoate |
| SMILES | COc1ccc(Cl)cc1/C(N)=N/OC(=O)CCn1cc(Br)cn1 |
| InChI | InChI=1S/C14H14BrClN4O3/c1-22-12-3-2-10(16)6-11(12)14(17)19-23-13(21)4-5-20-8-9(15)7-18-20/h2-3,6-8H,4-5H2,1H3,(H2,17,19) |
| InChIKey | GTEZVERKQYVRMX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|