C12H9Cl3N4O2 — CID 19293792
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(4-chloropyrazol-1-yl)acetate (PubChem CID 19293792) has the molecular formula C12H9Cl3N4O2 and a molecular weight of 347.59 g/mol. Its IUPAC name is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(4-chloropyrazol-1-yl)acetate.
| Compound Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(4-chloropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 19293792 |
| Molecular Formula | C12H9Cl3N4O2 |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(4-chloropyrazol-1-yl)acetate |
| SMILES | N/C(=N\OC(=O)Cn1cc(Cl)cn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl3N4O2/c13-7-1-2-9(10(15)3-7)12(16)18-21-11(20)6-19-5-8(14)4-17-19/h1-5H,6H2,(H2,16,18) |
| InChIKey | HPCAOCXOBUAODH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|