C20H13Cl2N3O2S — CID 6183468
[(E)-[amino-(2,4-dichlorophenyl)methylidene]amino] phenothiazine-10-carboxylate (PubChem CID 6183468) has the molecular formula C20H13Cl2N3O2S and a molecular weight of 430.32 g/mol. Its IUPAC name is [(E)-[amino-(2,4-dichlorophenyl)methylidene]amino] phenothiazine-10-carboxylate.
| Compound Name | [(E)-[amino-(2,4-dichlorophenyl)methylidene]amino] phenothiazine-10-carboxylate |
|---|---|
| PubChem CID | 6183468 |
| Molecular Formula | C20H13Cl2N3O2S |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | [(E)-[amino-(2,4-dichlorophenyl)methylidene]amino] phenothiazine-10-carboxylate |
| SMILES | N/C(=N/OC(=O)N1c2ccccc2Sc2ccccc21)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H13Cl2N3O2S/c21-12-9-10-13(14(22)11-12)19(23)24-27-20(26)25-15-5-1-3-7-17(15)28-18-8-4-2-6-16(18)25/h1-11H,(H2,23,24) |
| InChIKey | OQJZSEOBQYODCN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|