About methylamino phenothiazine-10-carboxylate;hydrochloride
methylamino phenothiazine-10-carboxylate;hydrochloride (PubChem CID 16680311) has the molecular formula C14H13ClN2O2S
and a molecular weight of 308.79 g/mol. Its IUPAC name is methylamino phenothiazine-10-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methylamino phenothiazine-10-carboxylate;hydrochloride |
| PubChem CID | 16680311 |
| Molecular Formula | C14H13ClN2O2S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | methylamino phenothiazine-10-carboxylate;hydrochloride |
| SMILES | CNOC(=O)N1c2ccccc2Sc2ccccc21.Cl |
| InChI | InChI=1S/C14H12N2O2S.ClH/c1-15-18-14(17)16-10-6-2-4-8-12(10)19-13-9-5-3-7-11(13)16;/h2-9,15H,1H3;1H |
| InChIKey | PKFRYDXSQLCBFO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylamino phenothiazine-10-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylamino phenothiazine-10-carboxylate;hydrochloride?
The IUPAC name of methylamino phenothiazine-10-carboxylate;hydrochloride (CID 16680311) is methylamino phenothiazine-10-carboxylate;hydrochloride.
What is the SMILES notation for methylamino phenothiazine-10-carboxylate;hydrochloride?
The canonical SMILES for methylamino phenothiazine-10-carboxylate;hydrochloride is CNOC(=O)N1c2ccccc2Sc2ccccc21.Cl.
What is the InChIKey of methylamino phenothiazine-10-carboxylate;hydrochloride?
The InChIKey is PKFRYDXSQLCBFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2S.ClH/c1-15-18-14(17)16-10-6-2-4-8-12(10)19-13-9-5-3-7-11(13)16;/h2-9,15H,1H3;1H.
What are the key properties of methylamino phenothiazine-10-carboxylate;hydrochloride?
methylamino phenothiazine-10-carboxylate;hydrochloride has a molecular weight of 308.79 g/mol, XLogP of 3.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylamino phenothiazine-10-carboxylate;hydrochloride is sourced from PubChem (CID 16680311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).