C19H25NOS — CID 158923820
2,2-dimethyl-1-phenothiazin-10-ylpropan-1-one;methane (PubChem CID 158923820) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is 2,2-dimethyl-1-phenothiazin-10-ylpropan-1-one;methane.
| Compound Name | 2,2-dimethyl-1-phenothiazin-10-ylpropan-1-one;methane |
|---|---|
| PubChem CID | 158923820 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2,2-dimethyl-1-phenothiazin-10-ylpropan-1-one;methane |
| SMILES | C.C.CC(C)(C)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C17H17NOS.2CH4/c1-17(2,3)16(19)18-12-8-4-6-10-14(12)20-15-11-7-5-9-13(15)18;;/h4-11H,1-3H3;2*1H4 |
| InChIKey | JIEHWTVFFDOTRQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |