C11H11NOS2 — CID 163654376
1-[(2E)-2-(1-sulfanylethylidene)-1,3-benzothiazol-3-yl]ethanone (PubChem CID 163654376) has the molecular formula C11H11NOS2 and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-[(2E)-2-(1-sulfanylethylidene)-1,3-benzothiazol-3-yl]ethanone.
| Compound Name | 1-[(2E)-2-(1-sulfanylethylidene)-1,3-benzothiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 163654376 |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 1-[(2E)-2-(1-sulfanylethylidene)-1,3-benzothiazol-3-yl]ethanone |
| SMILES | CC(=O)N1/C(=C(/C)S)Sc2ccccc21 |
| InChI | InChI=1S/C11H11NOS2/c1-7(14)11-12(8(2)13)9-5-3-4-6-10(9)15-11/h3-6,14H,1-2H3/b11-7+ |
| InChIKey | IOXGIDNFHNRUPX-YRNVUSSQSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|