About (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate
(2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate (PubChem CID 23848966) has the molecular formula C23H19NO4S
and a molecular weight of 405.48 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate.
Molecular Properties
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate |
| PubChem CID | 23848966 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate |
| SMILES | CC(Oc1ccccc1)C(=O)OCC(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C23H19NO4S/c1-16(28-17-9-3-2-4-10-17)23(26)27-15-22(25)24-18-11-5-7-13-20(18)29-21-14-8-6-12-19(21)24/h2-14,16H,15H2,1H3 |
| InChIKey | UPQKJXCRVGLVFK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate?
The IUPAC name of (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate (CID 23848966) is (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate.
What is the SMILES notation for (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate?
The canonical SMILES for (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate is CC(Oc1ccccc1)C(=O)OCC(=O)N1c2ccccc2Sc2ccccc21.
What is the InChIKey of (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate?
The InChIKey is UPQKJXCRVGLVFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO4S/c1-16(28-17-9-3-2-4-10-17)23(26)27-15-22(25)24-18-11-5-7-13-20(18)29-21-14-8-6-12-19(21)24/h2-14,16H,15H2,1H3.
What are the key properties of (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate?
(2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate has a molecular weight of 405.48 g/mol, XLogP of 4.83, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-2-phenothiazin-10-ylethyl) 2-phenoxypropanoate is sourced from PubChem (CID 23848966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).