C22H15Cl2NO3S — CID 3608464
(2-oxo-2-phenothiazin-10-ylethyl) 2-(2,6-dichlorophenyl)acetate (PubChem CID 3608464) has the molecular formula C22H15Cl2NO3S and a molecular weight of 444.34 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 2-(2,6-dichlorophenyl)acetate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-(2,6-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 3608464 |
| Molecular Formula | C22H15Cl2NO3S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-(2,6-dichlorophenyl)acetate |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)OCC(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C22H15Cl2NO3S/c23-15-6-5-7-16(24)14(15)12-22(27)28-13-21(26)25-17-8-1-3-10-19(17)29-20-11-4-2-9-18(20)25/h1-11H,12-13H2 |
| InChIKey | TZZJYBYKNXQVEJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |