C22H23NO3S — CID 2092512
(2-oxo-2-phenothiazin-10-ylethyl) 2-cyclohexylacetate (PubChem CID 2092512) has the molecular formula C22H23NO3S and a molecular weight of 381.50 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 2-cyclohexylacetate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-cyclohexylacetate |
|---|---|
| PubChem CID | 2092512 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-cyclohexylacetate |
| SMILES | O=C(CC1CCCCC1)OCC(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C22H23NO3S/c24-21(15-26-22(25)14-16-8-2-1-3-9-16)23-17-10-4-6-12-19(17)27-20-13-7-5-11-18(20)23/h4-7,10-13,16H,1-3,8-9,14-15H2 |
| InChIKey | KFEYSWYWSKMXSH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |