C23H21N3O5S — CID 2493557
(2-oxo-2-phenothiazin-10-ylethyl) 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 2493557) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 2493557 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | O=C(CN1C(=O)NC2(CCCC2)C1=O)OCC(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C23H21N3O5S/c27-19(26-15-7-1-3-9-17(15)32-18-10-4-2-8-16(18)26)14-31-20(28)13-25-21(29)23(24-22(25)30)11-5-6-12-23/h1-4,7-10H,5-6,11-14H2,(H,24,30) |
| InChIKey | MZKVUXLHWUKEKN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|