C26H20N2O5S — CID 2417417
(2-oxo-2-phenothiazin-10-ylethyl) 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 2417417) has the molecular formula C26H20N2O5S and a molecular weight of 472.52 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 2417417 |
| Molecular Formula | C26H20N2O5S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)OCC(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C26H20N2O5S/c29-23(28-19-10-3-5-12-21(19)34-22-13-6-4-11-20(22)28)16-33-24(30)14-7-15-27-25(31)17-8-1-2-9-18(17)26(27)32/h1-6,8-13H,7,14-16H2 |
| InChIKey | WFVQFMLCVXSFEL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|