C18H20N2O6 — CID 9363317
(2-morpholin-4-yl-2-oxoethyl) 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 9363317) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 9363317 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H20N2O6/c21-15(19-8-10-25-11-9-19)12-26-16(22)6-3-7-20-17(23)13-4-1-2-5-14(13)18(20)24/h1-2,4-5H,3,6-12H2 |
| InChIKey | JUWVPIKCRHKIKW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|