C24H20N2O9P+ — CID 67892806
bis[4-(1,3-dioxoisoindol-2-yl)butanoyloxy]-oxophosphanium (PubChem CID 67892806) has the molecular formula C24H20N2O9P+ and a molecular weight of 511.40 g/mol. Its IUPAC name is bis[4-(1,3-dioxoisoindol-2-yl)butanoyloxy]-oxophosphanium.
| Compound Name | bis[4-(1,3-dioxoisoindol-2-yl)butanoyloxy]-oxophosphanium |
|---|---|
| PubChem CID | 67892806 |
| Molecular Formula | C24H20N2O9P+ |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | bis[4-(1,3-dioxoisoindol-2-yl)butanoyloxy]-oxophosphanium |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)O[P+](=O)OC(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H20N2O9P/c27-19(11-5-13-25-21(29)15-7-1-2-8-16(15)22(25)30)34-36(33)35-20(28)12-6-14-26-23(31)17-9-3-4-10-18(17)24(26)32/h1-4,7-10H,5-6,11-14H2/q+1 |
| InChIKey | HSRGDBBLZBJZIN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 144.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|