C11H11NO4P+ — CID 69272985
3-(1,3-dioxoisoindol-2-yl)propyl-hydroxy-oxophosphanium (PubChem CID 69272985) has the molecular formula C11H11NO4P+ and a molecular weight of 252.19 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl-hydroxy-oxophosphanium.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 69272985 |
| Molecular Formula | C11H11NO4P+ |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl-hydroxy-oxophosphanium |
| SMILES | O=C1c2ccccc2C(=O)N1CCC[P+](=O)O |
| InChI | InChI=1S/C11H10NO4P/c13-10-8-4-1-2-5-9(8)11(14)12(10)6-3-7-17(15)16/h1-2,4-5H,3,6-7H2/p+1 |
| InChIKey | KEWLYPZVOMXQAG-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|