C16H19NO4S — CID 10829605
methylsulfanylmethyl 6-(1,3-dioxoisoindol-2-yl)hexanoate (PubChem CID 10829605) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is methylsulfanylmethyl 6-(1,3-dioxoisoindol-2-yl)hexanoate.
| Compound Name | methylsulfanylmethyl 6-(1,3-dioxoisoindol-2-yl)hexanoate |
|---|---|
| PubChem CID | 10829605 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | methylsulfanylmethyl 6-(1,3-dioxoisoindol-2-yl)hexanoate |
| SMILES | CSCOC(=O)CCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H19NO4S/c1-22-11-21-14(18)9-3-2-6-10-17-15(19)12-7-4-5-8-13(12)16(17)20/h4-5,7-8H,2-3,6,9-11H2,1H3 |
| InChIKey | ANMVNPGLORXBNV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|