C20H23N3O5 — CID 7822048
[2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 7822048) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 7822048 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | C[C@@H]1Cc2ccccc2N1C(=O)COC(=O)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C20H23N3O5/c1-13-10-14-6-2-3-7-15(14)23(13)16(24)12-28-17(25)11-22-18(26)20(21-19(22)27)8-4-5-9-20/h2-3,6-7,13H,4-5,8-12H2,1H3,(H,21,27)/t13-/m1/s1 |
| InChIKey | ITARGLIBAYZSRT-CYBMUJFWSA-N |
| XLogP | 1.37 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|