C28H27N3O5 — CID 41236434
5,5-bis(4-methoxyphenyl)-3-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 41236434) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is 5,5-bis(4-methoxyphenyl)-3-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-bis(4-methoxyphenyl)-3-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41236434 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 5,5-bis(4-methoxyphenyl)-3-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)NC(=O)N(CC(=O)N3c4ccccc4C[C@@H]3C)C2=O)cc1 |
| InChI | InChI=1S/C28H27N3O5/c1-18-16-19-6-4-5-7-24(19)31(18)25(32)17-30-26(33)28(29-27(30)34,20-8-12-22(35-2)13-9-20)21-10-14-23(36-3)15-11-21/h4-15,18H,16-17H2,1-3H3,(H,29,34)/t18-/m0/s1 |
| InChIKey | FHWBEDGRAKNOMC-SFHVURJKSA-N |
| XLogP | 3.48 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|