C21H19N3O5 — CID 8597469
1-(4-methoxyphenyl)-3-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]imidazolidine-2,4,5-trione (PubChem CID 8597469) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-(4-methoxyphenyl)-3-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 8597469 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]imidazolidine-2,4,5-trione |
| SMILES | COc1ccc(N2C(=O)C(=O)N(CC(=O)N3c4ccccc4C[C@@H]3C)C2=O)cc1 |
| InChI | InChI=1S/C21H19N3O5/c1-13-11-14-5-3-4-6-17(14)23(13)18(25)12-22-19(26)20(27)24(21(22)28)15-7-9-16(29-2)10-8-15/h3-10,13H,11-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | AMJBKPCVZIEVDY-ZDUSSCGKSA-N |
| XLogP | 1.97 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|