C12H11N3O5 — CID 8597411
2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 8597411) has the molecular formula C12H11N3O5 and a molecular weight of 277.24 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | 2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 8597411 |
| Molecular Formula | C12H11N3O5 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccc(N2C(=O)C(=O)N(CC(N)=O)C2=O)cc1 |
| InChI | InChI=1S/C12H11N3O5/c1-20-8-4-2-7(3-5-8)15-11(18)10(17)14(12(15)19)6-9(13)16/h2-5H,6H2,1H3,(H2,13,16) |
| InChIKey | FBODHMACUVBSMW-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|