C22H23N3O5 — CID 7491838
2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-[(1R)-1-(4-methylphenyl)propyl]acetamide (PubChem CID 7491838) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-[(1R)-1-(4-methylphenyl)propyl]acetamide.
| Compound Name | 2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-[(1R)-1-(4-methylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 7491838 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-[(1R)-1-(4-methylphenyl)propyl]acetamide |
| SMILES | CC[C@@H](NC(=O)CN1C(=O)C(=O)N(c2ccc(OC)cc2)C1=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H23N3O5/c1-4-18(15-7-5-14(2)6-8-15)23-19(26)13-24-20(27)21(28)25(22(24)29)16-9-11-17(30-3)12-10-16/h5-12,18H,4,13H2,1-3H3,(H,23,26)/t18-/m1/s1 |
| InChIKey | JFCHCSUIKUNWFG-GOSISDBHSA-N |
| XLogP | 2.57 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|