C26H23N3O5 — CID 25470678
N-[(1R)-1,2-diphenylethyl]-2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 25470678) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-[(1R)-1,2-diphenylethyl]-2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(1R)-1,2-diphenylethyl]-2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 25470678 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[(1R)-1,2-diphenylethyl]-2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccc(N2C(=O)C(=O)N(CC(=O)N[C@H](Cc3ccccc3)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H23N3O5/c1-34-21-14-12-20(13-15-21)29-25(32)24(31)28(26(29)33)17-23(30)27-22(19-10-6-3-7-11-19)16-18-8-4-2-5-9-18/h2-15,22H,16-17H2,1H3,(H,27,30)/t22-/m1/s1 |
| InChIKey | XWKLJSCNCYCKFK-JOCHJYFZSA-N |
| XLogP | 3.09 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|