C12H10N2O5 — CID 131843957
methyl 2-(2,4,5-trioxo-3-phenylimidazolidin-1-yl)acetate (PubChem CID 131843957) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is methyl 2-(2,4,5-trioxo-3-phenylimidazolidin-1-yl)acetate.
| Compound Name | methyl 2-(2,4,5-trioxo-3-phenylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 131843957 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | methyl 2-(2,4,5-trioxo-3-phenylimidazolidin-1-yl)acetate |
| SMILES | COC(=O)CN1C(=O)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C12H10N2O5/c1-19-9(15)7-13-10(16)11(17)14(12(13)18)8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | AQWUTRZZDQNUKX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|