About methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate
methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate (PubChem CID 102278438) has the molecular formula C14H17N3O4
and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate |
| PubChem CID | 102278438 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)N(c2ccccc2)C(=O)C[C@@H]1CN |
| InChI | InChI=1S/C14H17N3O4/c1-21-13(19)9-16-11(8-15)7-12(18)17(14(16)20)10-5-3-2-4-6-10/h2-6,11H,7-9,15H2,1H3/t11-/m1/s1 |
| InChIKey | TXTMSJMZHPIGJI-LLVKDONJSA-N |
| XLogP | 0.35 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate?
The IUPAC name of methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate (CID 102278438) is methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate.
What is the SMILES notation for methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate?
The canonical SMILES for methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate is COC(=O)CN1C(=O)N(c2ccccc2)C(=O)C[C@@H]1CN.
What is the InChIKey of methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate?
The InChIKey is TXTMSJMZHPIGJI-LLVKDONJSA-N. The full InChI is InChI=1S/C14H17N3O4/c1-21-13(19)9-16-11(8-15)7-12(18)17(14(16)20)10-5-3-2-4-6-10/h2-6,11H,7-9,15H2,1H3/t11-/m1/s1.
What are the key properties of methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate?
methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate has a molecular weight of 291.31 g/mol, XLogP of 0.35, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(6R)-6-(aminomethyl)-2,4-dioxo-3-phenyl-1,3-diazinan-1-yl]acetate is sourced from PubChem (CID 102278438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).