C17H22N2O4 — CID 142133689
methyl 2-[3-benzyl-5-(2-methylpropyl)-2,4-dioxoimidazolidin-1-yl]acetate (PubChem CID 142133689) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is methyl 2-[3-benzyl-5-(2-methylpropyl)-2,4-dioxoimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[3-benzyl-5-(2-methylpropyl)-2,4-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 142133689 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | methyl 2-[3-benzyl-5-(2-methylpropyl)-2,4-dioxoimidazolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)N(Cc2ccccc2)C(=O)C1CC(C)C |
| InChI | InChI=1S/C17H22N2O4/c1-12(2)9-14-16(21)19(10-13-7-5-4-6-8-13)17(22)18(14)11-15(20)23-3/h4-8,12,14H,9-11H2,1-3H3 |
| InChIKey | WKHHLPHTUMMSJR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|