C18H24N2O4 — CID 3699759
2-[3-benzyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]-2-methylpropanoic acid (PubChem CID 3699759) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[3-benzyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]-2-methylpropanoic acid.
| Compound Name | 2-[3-benzyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 3699759 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-[3-benzyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]-2-methylpropanoic acid |
| SMILES | CC(C)CC1C(=O)N(C(C)(C)C(=O)O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H24N2O4/c1-12(2)10-14-15(21)20(18(3,4)16(22)23)17(24)19(14)11-13-8-6-5-7-9-13/h5-9,12,14H,10-11H2,1-4H3,(H,22,23) |
| InChIKey | XUNHSNDVQDXXGR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|