C23H26N2O4 — CID 4995514
2-[3-benzyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanoic acid (PubChem CID 4995514) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[3-benzyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanoic acid.
| Compound Name | 2-[3-benzyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 4995514 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[3-benzyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanoic acid |
| SMILES | CC(C)CC1C(=O)N(C(Cc2ccccc2)C(=O)O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H26N2O4/c1-16(2)13-19-21(26)25(20(22(27)28)14-17-9-5-3-6-10-17)23(29)24(19)15-18-11-7-4-8-12-18/h3-12,16,19-20H,13-15H2,1-2H3,(H,27,28) |
| InChIKey | LWUCUMIDTUSEIL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|