C13H13NO4S — CID 104570352
2-(3,5-dioxothiomorpholin-4-yl)-3-phenylpropanoic acid (PubChem CID 104570352) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-(3,5-dioxothiomorpholin-4-yl)-3-phenylpropanoic acid.
| Compound Name | 2-(3,5-dioxothiomorpholin-4-yl)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 104570352 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2-(3,5-dioxothiomorpholin-4-yl)-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)N1C(=O)CSCC1=O |
| InChI | InChI=1S/C13H13NO4S/c15-11-7-19-8-12(16)14(11)10(13(17)18)6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,17,18) |
| InChIKey | NQTSPRMXBKKWBP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|