C12H10NO3S2- — CID 7092094
(2S)-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-3-phenylpropanoate (PubChem CID 7092094) has the molecular formula C12H10NO3S2- and a molecular weight of 280.35 g/mol. Its IUPAC name is (2S)-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-3-phenylpropanoate.
| Compound Name | (2S)-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 7092094 |
| Molecular Formula | C12H10NO3S2- |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | (2S)-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-3-phenylpropanoate |
| SMILES | O=C([O-])[C@H](Cc1ccccc1)N1C(=O)CSC1=S |
| InChI | InChI=1S/C12H11NO3S2/c14-10-7-18-12(17)13(10)9(11(15)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,15,16)/p-1/t9-/m0/s1 |
| InChIKey | UYEXYXVZQPTYSV-VIFPVBQESA-M |
| XLogP | 0.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|