C16H18N2O4 — CID 69108687
(2R)-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-3-phenylpropanoic acid (PubChem CID 69108687) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2R)-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-3-phenylpropanoic acid.
| Compound Name | (2R)-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 69108687 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (2R)-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)N1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C16H18N2O4/c19-13(20)12(10-11-6-2-1-3-7-11)18-14(21)16(17-15(18)22)8-4-5-9-16/h1-3,6-7,12H,4-5,8-10H2,(H,17,22)(H,19,20)/t12-/m1/s1 |
| InChIKey | RIRMTASVJVURBL-GFCCVEGCSA-N |
| XLogP | 1.55 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|