C19H23N3O5 — CID 119366873
(2R)-2-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]-3-phenylpropanoic acid (PubChem CID 119366873) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is (2R)-2-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 119366873 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (2R)-2-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]-3-phenylpropanoic acid |
| SMILES | O=C(CCN1C(=O)NC2(CCCC2)C1=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H23N3O5/c23-15(20-14(16(24)25)12-13-6-2-1-3-7-13)8-11-22-17(26)19(21-18(22)27)9-4-5-10-19/h1-3,6-7,14H,4-5,8-12H2,(H,20,23)(H,21,27)(H,24,25)/t14-/m1/s1 |
| InChIKey | MAXKRYQCDUKKDB-CQSZACIVSA-N |
| XLogP | 1.05 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|