C18H21N3O5 — CID 119353211
2-[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]phenyl]acetic acid (PubChem CID 119353211) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]phenyl]acetic acid.
| Compound Name | 2-[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 119353211 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]phenyl]acetic acid |
| SMILES | CC(C(=O)Nc1ccccc1CC(=O)O)N1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C18H21N3O5/c1-11(21-16(25)18(20-17(21)26)8-4-5-9-18)15(24)19-13-7-3-2-6-12(13)10-14(22)23/h2-3,6-7,11H,4-5,8-10H2,1H3,(H,19,24)(H,20,26)(H,22,23) |
| InChIKey | AHNWJFYLGVUHIW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|