C20H25N3O4 — CID 2428270
(2R)-N-(3-acetylphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)propanamide (PubChem CID 2428270) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is (2R)-N-(3-acetylphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)propanamide.
| Compound Name | (2R)-N-(3-acetylphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)propanamide |
|---|---|
| PubChem CID | 2428270 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (2R)-N-(3-acetylphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)propanamide |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)N2C(=O)NC3(CCCCCC3)C2=O)c1 |
| InChI | InChI=1S/C20H25N3O4/c1-13(17(25)21-16-9-7-8-15(12-16)14(2)24)23-18(26)20(22-19(23)27)10-5-3-4-6-11-20/h7-9,12-13H,3-6,10-11H2,1-2H3,(H,21,25)(H,22,27)/t13-/m1/s1 |
| InChIKey | FKPSLGMPQDVNES-CYBMUJFWSA-N |
| XLogP | 2.86 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|