C21H28N4O5S — CID 55308746
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(3-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 55308746) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(3-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(3-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55308746 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(3-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CC(C(=O)Nc1cccc(S(=O)(=O)N2CCCCC2)c1)N1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C21H28N4O5S/c1-15(25-19(27)21(23-20(25)28)10-3-4-11-21)18(26)22-16-8-7-9-17(14-16)31(29,30)24-12-5-2-6-13-24/h7-9,14-15H,2-6,10-13H2,1H3,(H,22,26)(H,23,28) |
| InChIKey | VPBIGCQAQODBLK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|