C14H21N3O5 — CID 119362768
3-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoyl-methylamino]propanoic acid (PubChem CID 119362768) has the molecular formula C14H21N3O5 and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoyl-methylamino]propanoic acid.
| Compound Name | 3-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119362768 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoyl-methylamino]propanoic acid |
| SMILES | CC(C(=O)N(C)CCC(=O)O)N1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C14H21N3O5/c1-9(11(20)16(2)8-5-10(18)19)17-12(21)14(15-13(17)22)6-3-4-7-14/h9H,3-8H2,1-2H3,(H,15,22)(H,18,19) |
| InChIKey | OMQIHWGIJYFYQN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|