C16H28N4O3 — CID 119570259
N-[3-(aminomethyl)pentan-3-yl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide (PubChem CID 119570259) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide |
|---|---|
| PubChem CID | 119570259 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide |
| SMILES | CCC(CC)(CN)NC(=O)C(C)N1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C16H28N4O3/c1-4-15(5-2,10-17)18-12(21)11(3)20-13(22)16(19-14(20)23)8-6-7-9-16/h11H,4-10,17H2,1-3H3,(H,18,21)(H,19,23) |
| InChIKey | ONDDKRNGHFWZII-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|