C18H25ClN4O3 — CID 119548530
N-[2-(4-aminophenyl)ethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide;hydrochloride (PubChem CID 119548530) has the molecular formula C18H25ClN4O3 and a molecular weight of 380.88 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119548530 |
| Molecular Formula | C18H25ClN4O3 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide;hydrochloride |
| SMILES | CC(C(=O)NCCc1ccc(N)cc1)N1C(=O)NC2(CCCC2)C1=O.Cl |
| InChI | InChI=1S/C18H24N4O3.ClH/c1-12(15(23)20-11-8-13-4-6-14(19)7-5-13)22-16(24)18(21-17(22)25)9-2-3-10-18;/h4-7,12H,2-3,8-11,19H2,1H3,(H,20,23)(H,21,25);1H |
| InChIKey | XYDUEAJSYSZXLY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|