C17H17NO5 — CID 59351949
2-[(4S,7R)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-3-phenylpropanoic acid (PubChem CID 59351949) has the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-[(4S,7R)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-3-phenylpropanoic acid.
| Compound Name | 2-[(4S,7R)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 59351949 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[(4S,7R)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)N1C(=O)C2C(C1=O)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C17H17NO5/c19-15-13-11-6-7-12(23-11)14(13)16(20)18(15)10(17(21)22)8-9-4-2-1-3-5-9/h1-5,10-14H,6-8H2,(H,21,22)/t10?,11-,12+,13?,14? |
| InChIKey | NLVLTZYAQUJZMA-HPCMXSDISA-N |
| XLogP | 0.84 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|