C19H21NO4 — CID 932993
(2S)-2-[(3aR,4R,7aS)-4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3-phenylpropanoic acid (PubChem CID 932993) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2S)-2-[(3aR,4R,7aS)-4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(3aR,4R,7aS)-4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 932993 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (2S)-2-[(3aR,4R,7aS)-4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3-phenylpropanoic acid |
| SMILES | CC1=C[C@@H](C)[C@H]2C(=O)N([C@@H](Cc3ccccc3)C(=O)O)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C19H21NO4/c1-11-8-12(2)16-14(9-11)17(21)20(18(16)22)15(19(23)24)10-13-6-4-3-5-7-13/h3-8,12,14-16H,9-10H2,1-2H3,(H,23,24)/t12-,14+,15+,16-/m1/s1 |
| InChIKey | ROFIOFAMWLWFLJ-SYAUCNOPSA-N |
| XLogP | 2.27 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|