C23H26N4O3 — CID 2285252
(2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(4,6-dimethylpyrimidin-2-yl)-3-phenylpropanamide (PubChem CID 2285252) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(4,6-dimethylpyrimidin-2-yl)-3-phenylpropanamide.
| Compound Name | (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(4,6-dimethylpyrimidin-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 2285252 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(4,6-dimethylpyrimidin-2-yl)-3-phenylpropanamide |
| SMILES | Cc1cc(C)nc(NC(=O)[C@@H](Cc2ccccc2)N2C(=O)[C@H]3CCCC[C@H]3C2=O)n1 |
| InChI | InChI=1S/C23H26N4O3/c1-14-12-15(2)25-23(24-14)26-20(28)19(13-16-8-4-3-5-9-16)27-21(29)17-10-6-7-11-18(17)22(27)30/h3-5,8-9,12,17-19H,6-7,10-11,13H2,1-2H3,(H,24,25,26,28)/t17-,18+,19-/m1/s1 |
| InChIKey | HFVXNRINUXJUCC-CEXWTWQISA-N |
| XLogP | 2.82 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|