C20H25N5O2 — CID 135260424
2-[3-[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]propyl]isoindole-1,3-dione (PubChem CID 135260424) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[3-[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135260424 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2-[3-[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]propyl]isoindole-1,3-dione |
| SMILES | CCCCNc1nc(N)nc(C)c1CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H25N5O2/c1-3-4-11-22-17-14(13(2)23-20(21)24-17)10-7-12-25-18(26)15-8-5-6-9-16(15)19(25)27/h5-6,8-9H,3-4,7,10-12H2,1-2H3,(H3,21,22,23,24) |
| InChIKey | VMDBQXAIUGAYHI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|